C24H33N3O4S — CID 133224920
4-(4-methoxy-N-methylsulfonylanilino)-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide (PubChem CID 133224920) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 4-(4-methoxy-N-methylsulfonylanilino)-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide.
| Compound Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 133224920 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide |
| SMILES | COc1ccc(N(CCCC(=O)NCCCN2c3ccccc3CC2C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H33N3O4S/c1-19-18-20-8-4-5-9-23(20)26(19)16-7-15-25-24(28)10-6-17-27(32(3,29)30)21-11-13-22(31-2)14-12-21/h4-5,8-9,11-14,19H,6-7,10,15-18H2,1-3H3,(H,25,28) |
| InChIKey | UZFKNHZQNDHQBO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|