C24H33N3O4S — CID 100760214
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 100760214) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100760214 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | COc1cccc(N(CCCC(=O)NCCCN2CCc3ccccc3C2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H33N3O4S/c1-31-23-11-5-10-22(18-23)27(32(2,29)30)16-6-12-24(28)25-14-7-15-26-17-13-20-8-3-4-9-21(20)19-26/h3-5,8-11,18H,6-7,12-17,19H2,1-2H3,(H,25,28) |
| InChIKey | OKMZESWZXKJEGN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|