C22H27F2N3O3S — CID 125063653
(2S)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide (PubChem CID 125063653) has the molecular formula C22H27F2N3O3S and a molecular weight of 451.54 g/mol. Its IUPAC name is (2S)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide.
| Compound Name | (2S)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 125063653 |
| Molecular Formula | C22H27F2N3O3S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (2S)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide |
| SMILES | C[C@@H]1Cc2ccccc2N1CCCNC(=O)[C@H](C)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C22H27F2N3O3S/c1-15-13-17-7-4-5-8-21(17)26(15)12-6-11-25-22(28)16(2)27(31(3,29)30)18-9-10-19(23)20(24)14-18/h4-5,7-10,14-16H,6,11-13H2,1-3H3,(H,25,28)/t15-,16+/m1/s1 |
| InChIKey | BAENFRNBGJEPNZ-CVEARBPZSA-N |
| XLogP | 3.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|