C22H29N3O3S — CID 133262206
N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide (PubChem CID 133262206) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide.
| Compound Name | N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 133262206 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]-2-[methyl(methylsulfonyl)amino]-2-phenylacetamide |
| SMILES | CC1Cc2ccccc2N1CCCNC(=O)C(c1ccccc1)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C22H29N3O3S/c1-17-16-19-12-7-8-13-20(19)25(17)15-9-14-23-22(26)21(24(2)29(3,27)28)18-10-5-4-6-11-18/h4-8,10-13,17,21H,9,14-16H2,1-3H3,(H,23,26) |
| InChIKey | QRWDLJMZLYMWDM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|