C26H28N2O — CID 100517277
N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(4-phenylphenyl)acetamide (PubChem CID 100517277) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 100517277 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(4-phenylphenyl)acetamide |
| SMILES | C[C@@H]1Cc2ccccc2N1CCCNC(=O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O/c1-20-18-24-10-5-6-11-25(24)28(20)17-7-16-27-26(29)19-21-12-14-23(15-13-21)22-8-3-2-4-9-22/h2-6,8-15,20H,7,16-19H2,1H3,(H,27,29)/t20-/m1/s1 |
| InChIKey | JJIANVPAOXWHCC-HXUWFJFHSA-N |
| XLogP | 4.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|