C22H28N4OS — CID 100740727
N,N-dimethyl-4-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propylcarbamothioylamino]benzamide (PubChem CID 100740727) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propylcarbamothioylamino]benzamide.
| Compound Name | N,N-dimethyl-4-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 100740727 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N,N-dimethyl-4-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propylcarbamothioylamino]benzamide |
| SMILES | C[C@@H]1Cc2ccccc2N1CCCNC(=S)Nc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C22H28N4OS/c1-16-15-18-7-4-5-8-20(18)26(16)14-6-13-23-22(28)24-19-11-9-17(10-12-19)21(27)25(2)3/h4-5,7-12,16H,6,13-15H2,1-3H3,(H2,23,24,28)/t16-/m1/s1 |
| InChIKey | NGVNDAYLYSLVNC-MRXNPFEDSA-N |
| XLogP | 3.52 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|