C21H27N3OS — CID 125048440
1-(2-ethoxyphenyl)-3-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]thiourea (PubChem CID 125048440) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]thiourea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 125048440 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]thiourea |
| SMILES | CCOc1ccccc1NC(=S)NCCCN1c2ccccc2C[C@H]1C |
| InChI | InChI=1S/C21H27N3OS/c1-3-25-20-12-7-5-10-18(20)23-21(26)22-13-8-14-24-16(2)15-17-9-4-6-11-19(17)24/h4-7,9-12,16H,3,8,13-15H2,1-2H3,(H2,22,23,26)/t16-/m1/s1 |
| InChIKey | LSKBJEHDOMUAKI-MRXNPFEDSA-N |
| XLogP | 4.21 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|