C23H29N3O2S — CID 133216906
ethyl 3-methyl-4-[3-(2-methyl-2,3-dihydroindol-1-yl)propylcarbamothioylamino]benzoate (PubChem CID 133216906) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is ethyl 3-methyl-4-[3-(2-methyl-2,3-dihydroindol-1-yl)propylcarbamothioylamino]benzoate.
| Compound Name | ethyl 3-methyl-4-[3-(2-methyl-2,3-dihydroindol-1-yl)propylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 133216906 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | ethyl 3-methyl-4-[3-(2-methyl-2,3-dihydroindol-1-yl)propylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NCCCN2c3ccccc3CC2C)c(C)c1 |
| InChI | InChI=1S/C23H29N3O2S/c1-4-28-22(27)19-10-11-20(16(2)14-19)25-23(29)24-12-7-13-26-17(3)15-18-8-5-6-9-21(18)26/h5-6,8-11,14,17H,4,7,12-13,15H2,1-3H3,(H2,24,25,29) |
| InChIKey | YHHGBWCFLDUIBB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|