C19H24N4S — CID 125048128
1-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-3-(5-methyl-2-pyridinyl)thiourea (PubChem CID 125048128) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-3-(5-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-3-(5-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 125048128 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-3-(5-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCN2c3ccccc3C[C@H]2C)nc1 |
| InChI | InChI=1S/C19H24N4S/c1-14-8-9-18(21-13-14)22-19(24)20-10-5-11-23-15(2)12-16-6-3-4-7-17(16)23/h3-4,6-9,13,15H,5,10-12H2,1-2H3,(H2,20,21,22,24)/t15-/m1/s1 |
| InChIKey | GCXHXWVLYIPQKA-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|