C21H26N2O — CID 125059686
2,4-dimethyl-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]benzamide (PubChem CID 125059686) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 125059686 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2,4-dimethyl-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCCN2c3ccccc3C[C@H]2C)c(C)c1 |
| InChI | InChI=1S/C21H26N2O/c1-15-9-10-19(16(2)13-15)21(24)22-11-6-12-23-17(3)14-18-7-4-5-8-20(18)23/h4-5,7-10,13,17H,6,11-12,14H2,1-3H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | FKXCYNCXQCXTJL-QGZVFWFLSA-N |
| XLogP | 3.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|