C18H18FIN2O — CID 60616291
5-fluoro-2-iodo-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]benzamide (PubChem CID 60616291) has the molecular formula C18H18FIN2O and a molecular weight of 424.26 g/mol. Its IUPAC name is 5-fluoro-2-iodo-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]benzamide.
| Compound Name | 5-fluoro-2-iodo-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 60616291 |
| Molecular Formula | C18H18FIN2O |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 5-fluoro-2-iodo-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]benzamide |
| SMILES | CC1Cc2ccccc2N1CCNC(=O)c1cc(F)ccc1I |
| InChI | InChI=1S/C18H18FIN2O/c1-12-10-13-4-2-3-5-17(13)22(12)9-8-21-18(23)15-11-14(19)6-7-16(15)20/h2-7,11-12H,8-10H2,1H3,(H,21,23) |
| InChIKey | NMSTWAHOXKRMDU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|