C16H25N3O2 — CID 111337321
1-(3-hydroxybutyl)-3-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]urea (PubChem CID 111337321) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-(3-hydroxybutyl)-3-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]urea.
| Compound Name | 1-(3-hydroxybutyl)-3-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 111337321 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-(3-hydroxybutyl)-3-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]urea |
| SMILES | CC(O)CCNC(=O)NCCN1c2ccccc2CC1C |
| InChI | InChI=1S/C16H25N3O2/c1-12-11-14-5-3-4-6-15(14)19(12)10-9-18-16(21)17-8-7-13(2)20/h3-6,12-13,20H,7-11H2,1-2H3,(H2,17,18,21) |
| InChIKey | TUQHJLMBHPJUMT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |