C24H30N2O2 — CID 100750796
N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide (PubChem CID 100750796) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide.
| Compound Name | N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
|---|---|
| PubChem CID | 100750796 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
| SMILES | C[C@@H]1Cc2ccccc2N1CCCNC(=O)COc1cccc2c1CCCC2 |
| InChI | InChI=1S/C24H30N2O2/c1-18-16-20-9-3-5-12-22(20)26(18)15-7-14-25-24(27)17-28-23-13-6-10-19-8-2-4-11-21(19)23/h3,5-6,9-10,12-13,18H,2,4,7-8,11,14-17H2,1H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | NRHIQNLFQHGLAZ-GOSISDBHSA-N |
| XLogP | 3.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|