C20H31F2N3O3S — CID 100646941
(2R)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide (PubChem CID 100646941) has the molecular formula C20H31F2N3O3S and a molecular weight of 431.55 g/mol. Its IUPAC name is (2R)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide.
| Compound Name | (2R)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 100646941 |
| Molecular Formula | C20H31F2N3O3S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (2R)-2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)[C@@H](C)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H31F2N3O3S/c1-4-16-8-5-6-12-24(16)13-7-11-23-20(26)15(2)25(29(3,27)28)17-9-10-18(21)19(22)14-17/h9-10,14-16H,4-8,11-13H2,1-3H3,(H,23,26)/t15-,16-/m1/s1 |
| InChIKey | SEJBHNULIFBKTI-HZPDHXFCSA-N |
| XLogP | 2.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|