C21H34N2O4S — CID 100710859
N-(3-cyclopentyloxypropyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 100710859) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100710859 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | Cc1cccc(N(CCCC(=O)NCCCOC2CCCC2)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C21H34N2O4S/c1-17-9-6-12-20(18(17)2)23(28(3,25)26)15-7-13-21(24)22-14-8-16-27-19-10-4-5-11-19/h6,9,12,19H,4-5,7-8,10-11,13-16H2,1-3H3,(H,22,24) |
| InChIKey | GNQWKUWWQZCGNE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|