C22H30N2O4S — CID 30224429
N-(3-cyclohexyloxypropyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide (PubChem CID 30224429) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 30224429 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCOC1CCCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H30N2O4S/c1-29(26,27)24(21-14-7-10-18-9-5-6-13-20(18)21)17-22(25)23-15-8-16-28-19-11-3-2-4-12-19/h5-7,9-10,13-14,19H,2-4,8,11-12,15-17H2,1H3,(H,23,25) |
| InChIKey | SKDCEZVCWSJODG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|