C19H29N3O6S — CID 30254610
N-(3-cyclohexyloxypropyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide (PubChem CID 30254610) has the molecular formula C19H29N3O6S and a molecular weight of 427.52 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide |
|---|---|
| PubChem CID | 30254610 |
| Molecular Formula | C19H29N3O6S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)NCCCOC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C19H29N3O6S/c1-15-9-10-16(22(24)25)13-18(15)21(29(2,26)27)14-19(23)20-11-6-12-28-17-7-4-3-5-8-17/h9-10,13,17H,3-8,11-12,14H2,1-2H3,(H,20,23) |
| InChIKey | UGRNEFCTNWLNED-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|