C19H25N3O4S — CID 53286560
4-(2-ethoxy-N-methylsulfonylanilino)-N-(pyridin-4-ylmethyl)butanamide (PubChem CID 53286560) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 4-(2-ethoxy-N-methylsulfonylanilino)-N-(pyridin-4-ylmethyl)butanamide.
| Compound Name | 4-(2-ethoxy-N-methylsulfonylanilino)-N-(pyridin-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 53286560 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-(2-ethoxy-N-methylsulfonylanilino)-N-(pyridin-4-ylmethyl)butanamide |
| SMILES | CCOc1ccccc1N(CCCC(=O)NCc1ccncc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H25N3O4S/c1-3-26-18-8-5-4-7-17(18)22(27(2,24)25)14-6-9-19(23)21-15-16-10-12-20-13-11-16/h4-5,7-8,10-13H,3,6,9,14-15H2,1-2H3,(H,21,23) |
| InChIKey | ZOLZZXDQZXDLLH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |