C23H25N3O4S2 — CID 2969185
2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 2969185) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2969185 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCc1ccncc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-3-30-22-7-5-4-6-21(22)26(17-23(27)25-16-18-12-14-24-15-13-18)32(28,29)20-10-8-19(31-2)9-11-20/h4-15H,3,16-17H2,1-2H3,(H,25,27) |
| InChIKey | UACBCBYLGKXCNX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |