C24H26N2O5S2 — CID 53280106
2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-methoxyphenyl)acetamide (PubChem CID 53280106) has the molecular formula C24H26N2O5S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53280106 |
| Molecular Formula | C24H26N2O5S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)Nc1ccc(OC)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C24H26N2O5S2/c1-4-31-23-8-6-5-7-22(23)26(33(28,29)21-15-13-20(32-3)14-16-21)17-24(27)25-18-9-11-19(30-2)12-10-18/h5-16H,4,17H2,1-3H3,(H,25,27) |
| InChIKey | QYGZUIZHELOJCB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |