C28H26N2O5S — CID 51345277
2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-(4-phenoxyphenyl)acetamide (PubChem CID 51345277) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51345277 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-(4-phenoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)Nc1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O5S/c1-2-34-27-16-10-9-15-26(27)30(36(32,33)25-13-7-4-8-14-25)21-28(31)29-22-17-19-24(20-18-22)35-23-11-5-3-6-12-23/h3-20H,2,21H2,1H3,(H,29,31) |
| InChIKey | QMBZIESOGDEYHO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |