C27H32N2O4S2 — CID 4036531
N-(4-butylphenyl)-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 4036531) has the molecular formula C27H32N2O4S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 4036531 |
| Molecular Formula | C27H32N2O4S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-(4-butylphenyl)-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCCCc1ccc(NC(=O)CN(c2ccccc2OCC)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C27H32N2O4S2/c1-4-6-9-21-12-14-22(15-13-21)28-27(30)20-29(25-10-7-8-11-26(25)33-5-2)35(31,32)24-18-16-23(34-3)17-19-24/h7-8,10-19H,4-6,9,20H2,1-3H3,(H,28,30) |
| InChIKey | KMKWNBNIFQMDKW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |