C25H27FN2O3S2 — CID 30270668
N-(4-butylphenyl)-2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 30270668) has the molecular formula C25H27FN2O3S2 and a molecular weight of 486.63 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30270668 |
| Molecular Formula | C25H27FN2O3S2 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N-(4-butylphenyl)-2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCCCc1ccc(NC(=O)CN(c2cccc(F)c2)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C25H27FN2O3S2/c1-3-4-6-19-9-11-21(12-10-19)27-25(29)18-28(22-8-5-7-20(26)17-22)33(30,31)24-15-13-23(32-2)14-16-24/h5,7-17H,3-4,6,18H2,1-2H3,(H,27,29) |
| InChIKey | MNTUTFJSOUNCBJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |