C28H35N3O4S2 — CID 100695196
N-[[4-(diethylamino)phenyl]methyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 100695196) has the molecular formula C28H35N3O4S2 and a molecular weight of 541.74 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 100695196 |
| Molecular Formula | C28H35N3O4S2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCc1ccc(N(CC)CC)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C28H35N3O4S2/c1-5-30(6-2)23-14-12-22(13-15-23)20-29-28(32)21-31(26-10-8-9-11-27(26)35-7-3)37(33,34)25-18-16-24(36-4)17-19-25/h8-19H,5-7,20-21H2,1-4H3,(H,29,32) |
| InChIKey | KKXSPPIAVKLZKG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|