C27H31N3O5S2 — CID 100519780
2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 100519780) has the molecular formula C27H31N3O5S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100519780 |
| Molecular Formula | C27H31N3O5S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)Nc1ccc(N2CCOCC2)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C27H31N3O5S2/c1-3-35-26-7-5-4-6-25(26)30(37(32,33)24-14-12-23(36-2)13-15-24)20-27(31)28-21-8-10-22(11-9-21)29-16-18-34-19-17-29/h4-15H,3,16-20H2,1-2H3,(H,28,31) |
| InChIKey | QBTUEVACQNVXFD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|