C8H13N3OS2 — CID 5179103
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentanamide (PubChem CID 5179103) has the molecular formula C8H13N3OS2 and a molecular weight of 231.35 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentanamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 5179103 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(SC)s1 |
| InChI | InChI=1S/C8H13N3OS2/c1-3-4-5-6(12)9-7-10-11-8(13-2)14-7/h3-5H2,1-2H3,(H,9,10,12) |
| InChIKey | KZXUISVBJIJZFS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|