C9H16N4OS — CID 114754330
N-(5-amino-1,3,4-thiadiazol-2-yl)heptanamide (PubChem CID 114754330) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is N-(5-amino-1,3,4-thiadiazol-2-yl)heptanamide.
| Compound Name | N-(5-amino-1,3,4-thiadiazol-2-yl)heptanamide |
|---|---|
| PubChem CID | 114754330 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-(5-amino-1,3,4-thiadiazol-2-yl)heptanamide |
| SMILES | CCCCCCC(=O)Nc1nnc(N)s1 |
| InChI | InChI=1S/C9H16N4OS/c1-2-3-4-5-6-7(14)11-9-13-12-8(10)15-9/h2-6H2,1H3,(H2,10,12)(H,11,13,14) |
| InChIKey | KJWUFPCWVQOUOI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|