C16H29N3OS2 — CID 3276028
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)dodecanamide (PubChem CID 3276028) has the molecular formula C16H29N3OS2 and a molecular weight of 343.56 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)dodecanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)dodecanamide |
|---|---|
| PubChem CID | 3276028 |
| Molecular Formula | C16H29N3OS2 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)dodecanamide |
| SMILES | CCCCCCCCCCCC(=O)Nc1nnc(SCC)s1 |
| InChI | InChI=1S/C16H29N3OS2/c1-3-5-6-7-8-9-10-11-12-13-14(20)17-15-18-19-16(22-15)21-4-2/h3-13H2,1-2H3,(H,17,18,20) |
| InChIKey | ATSPFHNUUMPCLP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|