C12H18N4O4S2 — CID 166394237
7-[[5-[2-(methylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-7-oxoheptanoic acid (PubChem CID 166394237) has the molecular formula C12H18N4O4S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 7-[[5-[2-(methylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-7-oxoheptanoic acid.
| Compound Name | 7-[[5-[2-(methylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 166394237 |
| Molecular Formula | C12H18N4O4S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 7-[[5-[2-(methylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-7-oxoheptanoic acid |
| SMILES | CNC(=O)CSc1nnc(NC(=O)CCCCCC(=O)O)s1 |
| InChI | InChI=1S/C12H18N4O4S2/c1-13-9(18)7-21-12-16-15-11(22-12)14-8(17)5-3-2-4-6-10(19)20/h2-7H2,1H3,(H,13,18)(H,19,20)(H,14,15,17) |
| InChIKey | VIMJKRIVOMNSPL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|