C9H11N3O3S2 — CID 61284339
2-[[5-[(2-cyclopropylacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 61284339) has the molecular formula C9H11N3O3S2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[[5-[(2-cyclopropylacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(2-cyclopropylacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 61284339 |
| Molecular Formula | C9H11N3O3S2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-[[5-[(2-cyclopropylacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(NC(=O)CC2CC2)s1 |
| InChI | InChI=1S/C9H11N3O3S2/c13-6(3-5-1-2-5)10-8-11-12-9(17-8)16-4-7(14)15/h5H,1-4H2,(H,14,15)(H,10,11,13) |
| InChIKey | FPTNGILBWDVQMI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|