C18H23ClN4OS2 — CID 119677545
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide;hydrochloride (PubChem CID 119677545) has the molecular formula C18H23ClN4OS2 and a molecular weight of 411.00 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119677545 |
| Molecular Formula | C18H23ClN4OS2 |
| Molecular Weight | 411.00 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CC2CCC(C1)N2)Nc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C18H22N4OS2.ClH/c23-16(10-13-8-14-6-7-15(9-13)19-14)20-17-21-22-18(25-17)24-11-12-4-2-1-3-5-12;/h1-5,13-15,19H,6-11H2,(H,20,21,23);1H |
| InChIKey | NLAPTCSRBXSARB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.00 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|