C20H19N3O2S4 — CID 43025617
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide (PubChem CID 43025617) has the molecular formula C20H19N3O2S4 and a molecular weight of 461.66 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 43025617 |
| Molecular Formula | C20H19N3O2S4 |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C2SCCS2)cc1)Nc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C20H19N3O2S4/c24-17(12-25-16-8-6-15(7-9-16)18-26-10-11-27-18)21-19-22-23-20(29-19)28-13-14-4-2-1-3-5-14/h1-9,18H,10-13H2,(H,21,22,24) |
| InChIKey | CTLGTLKAWRBZNF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|