C18H15N7O2S2 — CID 35271332
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide (PubChem CID 35271332) has the molecular formula C18H15N7O2S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 35271332 |
| Molecular Formula | C18H15N7O2S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(-n2cnnn2)cc1)Nc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C18H15N7O2S2/c26-16(10-27-15-8-6-14(7-9-15)25-12-19-23-24-25)20-17-21-22-18(29-17)28-11-13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,20,21,26) |
| InChIKey | GNNXEJIQAMHKGO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|