C21H22FN3O2S2 — CID 3319268
2-(4-tert-butylphenoxy)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 3319268) has the molecular formula C21H22FN3O2S2 and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3319268 |
| Molecular Formula | C21H22FN3O2S2 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Nc2nnc(SCc3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C21H22FN3O2S2/c1-21(2,3)15-8-10-16(11-9-15)27-12-18(26)23-19-24-25-20(29-19)28-13-14-6-4-5-7-17(14)22/h4-11H,12-13H2,1-3H3,(H,23,24,26) |
| InChIKey | ROABSEPWXGCCJE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|