C14H17ClN4OS2 — CID 119677563
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119677563) has the molecular formula C14H17ClN4OS2 and a molecular weight of 356.90 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119677563 |
| Molecular Formula | C14H17ClN4OS2 |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(SCc2ccccc2)s1)C1CCNC1 |
| InChI | InChI=1S/C14H16N4OS2.ClH/c19-12(11-6-7-15-8-11)16-13-17-18-14(21-13)20-9-10-4-2-1-3-5-10;/h1-5,11,15H,6-9H2,(H,16,17,19);1H |
| InChIKey | FUISUIWGUYWREG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|