C19H16N4O2S2 — CID 24591063
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 24591063) has the molecular formula C19H16N4O2S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 24591063 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2nnc(SCc3ccccc3)s2)c2ccccc2N1 |
| InChI | InChI=1S/C19H16N4O2S2/c24-16-10-14(13-8-4-5-9-15(13)20-16)17(25)21-18-22-23-19(27-18)26-11-12-6-2-1-3-7-12/h1-9,14H,10-11H2,(H,20,24)(H,21,22,25) |
| InChIKey | CYLGVDFOIRZQMO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|