C17H20N4O2S — CID 26005935
(4R)-2-oxo-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 26005935) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (4R)-2-oxo-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | (4R)-2-oxo-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 26005935 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4R)-2-oxo-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)[C@@H]2CC(=O)Nc3ccccc32)s1 |
| InChI | InChI=1S/C17H20N4O2S/c1-2-3-4-9-15-20-21-17(24-15)19-16(23)12-10-14(22)18-13-8-6-5-7-11(12)13/h5-8,12H,2-4,9-10H2,1H3,(H,18,22)(H,19,21,23)/t12-/m1/s1 |
| InChIKey | NEVVYNVCATZAOF-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|