C20H17BrN4O2S2 — CID 55883931
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 55883931) has the molecular formula C20H17BrN4O2S2 and a molecular weight of 489.42 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55883931 |
| Molecular Formula | C20H17BrN4O2S2 |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)C1CCN(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C20H17BrN4O2S2/c21-14-7-4-8-15(11-14)25-10-9-16(18(25)27)17(26)22-19-23-24-20(29-19)28-12-13-5-2-1-3-6-13/h1-8,11,16H,9-10,12H2,(H,22,23,26) |
| InChIKey | MPIQXXSNAUVWLS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|