C16H11BrClN3OS2 — CID 1315525
N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide (PubChem CID 1315525) has the molecular formula C16H11BrClN3OS2 and a molecular weight of 440.78 g/mol. Its IUPAC name is N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide.
| Compound Name | N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 1315525 |
| Molecular Formula | C16H11BrClN3OS2 |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide |
| SMILES | O=C(Nc1nnc(SCc2cccc(Br)c2)s1)c1ccccc1Cl |
| InChI | InChI=1S/C16H11BrClN3OS2/c17-11-5-3-4-10(8-11)9-23-16-21-20-15(24-16)19-14(22)12-6-1-2-7-13(12)18/h1-8H,9H2,(H,19,20,22) |
| InChIKey | PHHSIIYCMHBWRU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|