C16H9BrCl3N3OS2 — CID 100537532
5-bromo-2-chloro-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100537532) has the molecular formula C16H9BrCl3N3OS2 and a molecular weight of 509.67 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100537532 |
| Molecular Formula | C16H9BrCl3N3OS2 |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 506.84 |
| IUPAC Name | 5-bromo-2-chloro-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(SCc2c(Cl)cccc2Cl)s1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C16H9BrCl3N3OS2/c17-8-4-5-13(20)9(6-8)14(24)21-15-22-23-16(26-15)25-7-10-11(18)2-1-3-12(10)19/h1-6H,7H2,(H,21,22,24) |
| InChIKey | IUMIXOZLNOLUAI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|