C11H7Br2N3O3S2 — CID 114367954
2-[[5-[(2,5-dibromobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 114367954) has the molecular formula C11H7Br2N3O3S2 and a molecular weight of 453.14 g/mol. Its IUPAC name is 2-[[5-[(2,5-dibromobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(2,5-dibromobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 114367954 |
| Molecular Formula | C11H7Br2N3O3S2 |
| Molecular Weight | 453.14 g/mol |
| Exact Mass | 450.83 |
| IUPAC Name | 2-[[5-[(2,5-dibromobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(NC(=O)c2cc(Br)ccc2Br)s1 |
| InChI | InChI=1S/C11H7Br2N3O3S2/c12-5-1-2-7(13)6(3-5)9(19)14-10-15-16-11(21-10)20-4-8(17)18/h1-3H,4H2,(H,17,18)(H,14,15,19) |
| InChIKey | AHVABBIGTIXNLF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.14 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|