C12H10FN3O3S2 — CID 62516686
2-[[5-[(2-fluoro-5-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 62516686) has the molecular formula C12H10FN3O3S2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-[[5-[(2-fluoro-5-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(2-fluoro-5-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 62516686 |
| Molecular Formula | C12H10FN3O3S2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-[[5-[(2-fluoro-5-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | Cc1ccc(F)c(C(=O)Nc2nnc(SCC(=O)O)s2)c1 |
| InChI | InChI=1S/C12H10FN3O3S2/c1-6-2-3-8(13)7(4-6)10(19)14-11-15-16-12(21-11)20-5-9(17)18/h2-4H,5H2,1H3,(H,17,18)(H,14,15,19) |
| InChIKey | LPADBTODANTATF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|