C9H7N3O3S3 — CID 61285937
2-[[5-(thiophene-3-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 61285937) has the molecular formula C9H7N3O3S3 and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[[5-(thiophene-3-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(thiophene-3-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 61285937 |
| Molecular Formula | C9H7N3O3S3 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2-[[5-(thiophene-3-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(NC(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C9H7N3O3S3/c13-6(14)4-17-9-12-11-8(18-9)10-7(15)5-1-2-16-3-5/h1-3H,4H2,(H,13,14)(H,10,11,15) |
| InChIKey | BEONSFQNHJXUFD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|