C9H9N5O3S2 — CID 114022478
2-[[5-[(1-methylimidazole-4-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 114022478) has the molecular formula C9H9N5O3S2 and a molecular weight of 299.34 g/mol. Its IUPAC name is 2-[[5-[(1-methylimidazole-4-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(1-methylimidazole-4-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 114022478 |
| Molecular Formula | C9H9N5O3S2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-[[5-[(1-methylimidazole-4-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | Cn1cnc(C(=O)Nc2nnc(SCC(=O)O)s2)c1 |
| InChI | InChI=1S/C9H9N5O3S2/c1-14-2-5(10-4-14)7(17)11-8-12-13-9(19-8)18-3-6(15)16/h2,4H,3H2,1H3,(H,15,16)(H,11,12,17) |
| InChIKey | FLWZLSNMEZESQN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|