C9H9N5O3S3 — CID 65205894
2-[[5-[(4-ethylthiadiazole-5-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 65205894) has the molecular formula C9H9N5O3S3 and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[[5-[(4-ethylthiadiazole-5-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(4-ethylthiadiazole-5-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 65205894 |
| Molecular Formula | C9H9N5O3S3 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2-[[5-[(4-ethylthiadiazole-5-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | CCc1nnsc1C(=O)Nc1nnc(SCC(=O)O)s1 |
| InChI | InChI=1S/C9H9N5O3S3/c1-2-4-6(20-14-11-4)7(17)10-8-12-13-9(19-8)18-3-5(15)16/h2-3H2,1H3,(H,15,16)(H,10,12,17) |
| InChIKey | UNDRJMLGNHELMD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|