C13H12N6OS3 — CID 171355430
4-ethyl-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide (PubChem CID 171355430) has the molecular formula C13H12N6OS3 and a molecular weight of 364.48 g/mol. Its IUPAC name is 4-ethyl-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 171355430 |
| Molecular Formula | C13H12N6OS3 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 4-ethyl-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1nnc(SCc2ccccn2)s1 |
| InChI | InChI=1S/C13H12N6OS3/c1-2-9-10(23-19-16-9)11(20)15-12-17-18-13(22-12)21-7-8-5-3-4-6-14-8/h3-6H,2,7H2,1H3,(H,15,17,20) |
| InChIKey | BEENJBJEZNNQJA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|