C18H12N4O4S2 — CID 54726649
4-hydroxy-2-oxo-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide (PubChem CID 54726649) has the molecular formula C18H12N4O4S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide.
| Compound Name | 4-hydroxy-2-oxo-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 54726649 |
| Molecular Formula | C18H12N4O4S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 4-hydroxy-2-oxo-N-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccn2)s1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C18H12N4O4S2/c23-14-11-6-1-2-7-12(11)26-16(25)13(14)15(24)20-17-21-22-18(28-17)27-9-10-5-3-4-8-19-10/h1-8,23H,9H2,(H,20,21,24) |
| InChIKey | IJSUQEOKWMDGRV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|