C12H7N3O4S — CID 54726652
4-hydroxy-2-oxo-N-(1,3,4-thiadiazol-2-yl)chromene-3-carboxamide (PubChem CID 54726652) has the molecular formula C12H7N3O4S and a molecular weight of 289.27 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-N-(1,3,4-thiadiazol-2-yl)chromene-3-carboxamide.
| Compound Name | 4-hydroxy-2-oxo-N-(1,3,4-thiadiazol-2-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 54726652 |
| Molecular Formula | C12H7N3O4S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-hydroxy-2-oxo-N-(1,3,4-thiadiazol-2-yl)chromene-3-carboxamide |
| SMILES | O=C(Nc1nncs1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C12H7N3O4S/c16-9-6-3-1-2-4-7(6)19-11(18)8(9)10(17)14-12-15-13-5-20-12/h1-5,16H,(H,14,15,17) |
| InChIKey | IJZHAIFHMNFBBB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|