C16H12F3N5OS2 — CID 70088684
1-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 70088684) has the molecular formula C16H12F3N5OS2 and a molecular weight of 411.43 g/mol. Its IUPAC name is 1-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 70088684 |
| Molecular Formula | C16H12F3N5OS2 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 1-[5-(pyridin-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1nnc(SCc2ccccn2)s1 |
| InChI | InChI=1S/C16H12F3N5OS2/c17-16(18,19)10-4-3-6-11(8-10)21-13(25)22-14-23-24-15(27-14)26-9-12-5-1-2-7-20-12/h1-8H,9H2,(H2,21,22,23,25) |
| InChIKey | VOFWTZARNCXFQW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|