C15H16F3N5O3S2 — CID 43990843
2-[[5-(2-methoxyethylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 43990843) has the molecular formula C15H16F3N5O3S2 and a molecular weight of 435.45 g/mol. Its IUPAC name is 2-[[5-(2-methoxyethylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[5-(2-methoxyethylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43990843 |
| Molecular Formula | C15H16F3N5O3S2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2-[[5-(2-methoxyethylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCNC(=O)Nc1nnc(SCC(=O)Nc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H16F3N5O3S2/c1-26-6-5-19-12(25)21-13-22-23-14(28-13)27-8-11(24)20-10-4-2-3-9(7-10)15(16,17)18/h2-4,7H,5-6,8H2,1H3,(H,20,24)(H2,19,21,22,25) |
| InChIKey | DSFPUDIGUNBTSA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|